C20H27N2O8P — CID 11612196
[(2S)-2-amino-3-[4-[2-(3,4-dimethoxyphenyl)ethoxy]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate (PubChem CID 11612196) has the molecular formula C20H27N2O8P and a molecular weight of 454.42 g/mol. Its IUPAC name is [(2S)-2-amino-3-[4-[2-(3,4-dimethoxyphenyl)ethoxy]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-3-[4-[2-(3,4-dimethoxyphenyl)ethoxy]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11612196 |
| Molecular Formula | C20H27N2O8P |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [(2S)-2-amino-3-[4-[2-(3,4-dimethoxyphenyl)ethoxy]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
| SMILES | COc1ccc(CCOc2ccc(NC(=O)[C@@](C)(N)COP(=O)(O)O)cc2)cc1OC |
| InChI | InChI=1S/C20H27N2O8P/c1-20(21,13-30-31(24,25)26)19(23)22-15-5-7-16(8-6-15)29-11-10-14-4-9-17(27-2)18(12-14)28-3/h4-9,12H,10-11,13,21H2,1-3H3,(H,22,23)(H2,24,25,26)/t20-/m0/s1 |
| InChIKey | JOZFRJBWHNVVMY-FQEVSTJZSA-N |
| XLogP | 2.09 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|