C21H28N2O4 — CID 11639348
(2S)-2-amino-3-hydroxy-N-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropanamide (PubChem CID 11639348) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-N-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropanamide.
| Compound Name | (2S)-2-amino-3-hydroxy-N-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 11639348 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-N-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropanamide |
| SMILES | COc1ccc(CCCCOc2ccc(NC(=O)[C@@](C)(N)CO)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(22,15-24)20(25)23-17-8-12-19(13-9-17)27-14-4-3-5-16-6-10-18(26-2)11-7-16/h6-13,24H,3-5,14-15,22H2,1-2H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | YUIMOAIVEUAFHF-NRFANRHFSA-N |
| XLogP | 2.75 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|