C23H29F3N2O4 — CID 87704063
N-[2-amino-3-hydroxy-3-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 87704063) has the molecular formula C23H29F3N2O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[2-amino-3-hydroxy-3-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-amino-3-hydroxy-3-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87704063 |
| Molecular Formula | C23H29F3N2O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N-[2-amino-3-hydroxy-3-[4-[4-(4-methoxyphenyl)butoxy]phenyl]-2-methylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(CCCCOc2ccc(C(O)C(C)(N)CNC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H29F3N2O4/c1-22(27,15-28-21(30)23(24,25)26)20(29)17-8-12-19(13-9-17)32-14-4-3-5-16-6-10-18(31-2)11-7-16/h6-13,20,29H,3-5,14-15,27H2,1-2H3,(H,28,30) |
| InChIKey | LOPYKQUNLGAZTC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|