C20H26N2O3 — CID 73021177
2-amino-N-[4-(3-butoxyphenyl)phenyl]-3-hydroxy-2-methylpropanamide (PubChem CID 73021177) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-amino-N-[4-(3-butoxyphenyl)phenyl]-3-hydroxy-2-methylpropanamide.
| Compound Name | 2-amino-N-[4-(3-butoxyphenyl)phenyl]-3-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 73021177 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-amino-N-[4-(3-butoxyphenyl)phenyl]-3-hydroxy-2-methylpropanamide |
| SMILES | CCCCOc1cccc(-c2ccc(NC(=O)C(C)(N)CO)cc2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-4-12-25-18-7-5-6-16(13-18)15-8-10-17(11-9-15)22-19(24)20(2,21)14-23/h5-11,13,23H,3-4,12,14,21H2,1-2H3,(H,22,24) |
| InChIKey | USQQOFUGQWONID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|