C24H27N2O5PS — CID 58907532
[(2S)-2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfanyl]anilino]propyl] dihydrogen phosphate (PubChem CID 58907532) has the molecular formula C24H27N2O5PS and a molecular weight of 486.53 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfanyl]anilino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfanyl]anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58907532 |
| Molecular Formula | C24H27N2O5PS |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[2-(4-phenylphenyl)ethylsulfanyl]anilino]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(SCCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N2O5PS/c1-24(25,17-31-32(28,29)30)23(27)26-21-11-13-22(14-12-21)33-16-15-18-7-9-20(10-8-18)19-5-3-2-4-6-19/h2-14H,15-17,25H2,1H3,(H,26,27)(H2,28,29,30)/t24-/m0/s1 |
| InChIKey | SPEFMUHKUAIEEM-DEOSSOPVSA-N |
| XLogP | 4.45 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|