C26H31N2O6P — CID 58907596
[(2S)-2-amino-2-methyl-3-oxo-3-[4-[4-(4-phenylphenyl)butan-2-yloxy]anilino]propyl] dihydrogen phosphate (PubChem CID 58907596) has the molecular formula C26H31N2O6P and a molecular weight of 498.52 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-[4-(4-phenylphenyl)butan-2-yloxy]anilino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[4-(4-phenylphenyl)butan-2-yloxy]anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58907596 |
| Molecular Formula | C26H31N2O6P |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[4-(4-phenylphenyl)butan-2-yloxy]anilino]propyl] dihydrogen phosphate |
| SMILES | CC(CCc1ccc(-c2ccccc2)cc1)Oc1ccc(NC(=O)[C@@](C)(N)COP(=O)(O)O)cc1 |
| InChI | InChI=1S/C26H31N2O6P/c1-19(8-9-20-10-12-22(13-11-20)21-6-4-3-5-7-21)34-24-16-14-23(15-17-24)28-25(29)26(2,27)18-33-35(30,31)32/h3-7,10-17,19H,8-9,18,27H2,1-2H3,(H,28,29)(H2,30,31,32)/t19?,26-/m0/s1 |
| InChIKey | YMJHDTMRQRCVHY-SYCQMTRVSA-N |
| XLogP | 4.52 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|