C25H29N2O6P — CID 58907582
[(2S)-2-amino-2-methyl-3-oxo-3-[4-[(4-phenylphenyl)methoxy]anilino]propyl] ethyl hydrogen phosphate (PubChem CID 58907582) has the molecular formula C25H29N2O6P and a molecular weight of 484.49 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-[(4-phenylphenyl)methoxy]anilino]propyl] ethyl hydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[(4-phenylphenyl)methoxy]anilino]propyl] ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 58907582 |
| Molecular Formula | C25H29N2O6P |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-[(4-phenylphenyl)methoxy]anilino]propyl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OC[C@](C)(N)C(=O)Nc1ccc(OCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H29N2O6P/c1-3-32-34(29,30)33-18-25(2,26)24(28)27-22-13-15-23(16-14-22)31-17-19-9-11-21(12-10-19)20-7-5-4-6-8-20/h4-16H,3,17-18,26H2,1-2H3,(H,27,28)(H,29,30)/t25-/m0/s1 |
| InChIKey | OHOIHTSYYDGRBZ-VWLOTQADSA-N |
| XLogP | 4.74 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|