C26H30N2O3 — CID 58907580
(2S)-2-amino-3-(4-ethylphenoxy)-N-[4-(4-ethylphenoxy)phenyl]-2-methylpropanamide (PubChem CID 58907580) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-ethylphenoxy)-N-[4-(4-ethylphenoxy)phenyl]-2-methylpropanamide.
| Compound Name | (2S)-2-amino-3-(4-ethylphenoxy)-N-[4-(4-ethylphenoxy)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58907580 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (2S)-2-amino-3-(4-ethylphenoxy)-N-[4-(4-ethylphenoxy)phenyl]-2-methylpropanamide |
| SMILES | CCc1ccc(OC[C@](C)(N)C(=O)Nc2ccc(Oc3ccc(CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-4-19-6-12-22(13-7-19)30-18-26(3,27)25(29)28-21-10-16-24(17-11-21)31-23-14-8-20(5-2)9-15-23/h6-17H,4-5,18,27H2,1-3H3,(H,28,29)/t26-/m0/s1 |
| InChIKey | GAJBIFMEKHORCX-SANMLTNESA-N |
| XLogP | 5.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |