C25H27N2O6P — CID 69266346
[2-amino-2-methyl-3-oxo-3-[4-[3-(4-phenylphenyl)propanoyl]anilino]propyl] dihydrogen phosphate (PubChem CID 69266346) has the molecular formula C25H27N2O6P and a molecular weight of 482.47 g/mol. Its IUPAC name is [2-amino-2-methyl-3-oxo-3-[4-[3-(4-phenylphenyl)propanoyl]anilino]propyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-methyl-3-oxo-3-[4-[3-(4-phenylphenyl)propanoyl]anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69266346 |
| Molecular Formula | C25H27N2O6P |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [2-amino-2-methyl-3-oxo-3-[4-[3-(4-phenylphenyl)propanoyl]anilino]propyl] dihydrogen phosphate |
| SMILES | CC(N)(COP(=O)(O)O)C(=O)Nc1ccc(C(=O)CCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H27N2O6P/c1-25(26,17-33-34(30,31)32)24(29)27-22-14-12-21(13-15-22)23(28)16-9-18-7-10-20(11-8-18)19-5-3-2-4-6-19/h2-8,10-15H,9,16-17,26H2,1H3,(H,27,29)(H2,30,31,32) |
| InChIKey | KNLPKQCGTFMRRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|