C26H28N2O — CID 89340926
1-[4-[[(3S)-3-aminopent-1-en-2-yl]amino]phenyl]-3-(4-phenylphenyl)propan-1-one (PubChem CID 89340926) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[4-[[(3S)-3-aminopent-1-en-2-yl]amino]phenyl]-3-(4-phenylphenyl)propan-1-one.
| Compound Name | 1-[4-[[(3S)-3-aminopent-1-en-2-yl]amino]phenyl]-3-(4-phenylphenyl)propan-1-one |
|---|---|
| PubChem CID | 89340926 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[4-[[(3S)-3-aminopent-1-en-2-yl]amino]phenyl]-3-(4-phenylphenyl)propan-1-one |
| SMILES | C=C(Nc1ccc(C(=O)CCc2ccc(-c3ccccc3)cc2)cc1)[C@@H](N)CC |
| InChI | InChI=1S/C26H28N2O/c1-3-25(27)19(2)28-24-16-14-23(15-17-24)26(29)18-11-20-9-12-22(13-10-20)21-7-5-4-6-8-21/h4-10,12-17,25,28H,2-3,11,18,27H2,1H3/t25-/m0/s1 |
| InChIKey | LYJAJUCWFKLXDS-VWLOTQADSA-N |
| XLogP | 5.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |