C18H25N2O6PS — CID 44565621
[(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-thiophen-2-ylbutoxy)anilino]propyl] dihydrogen phosphate (PubChem CID 44565621) has the molecular formula C18H25N2O6PS and a molecular weight of 428.45 g/mol. Its IUPAC name is [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-thiophen-2-ylbutoxy)anilino]propyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-thiophen-2-ylbutoxy)anilino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 44565621 |
| Molecular Formula | C18H25N2O6PS |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [(2S)-2-amino-2-methyl-3-oxo-3-[4-(4-thiophen-2-ylbutoxy)anilino]propyl] dihydrogen phosphate |
| SMILES | C[C@](N)(COP(=O)(O)O)C(=O)Nc1ccc(OCCCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H25N2O6PS/c1-18(19,13-26-27(22,23)24)17(21)20-14-7-9-15(10-8-14)25-11-3-2-5-16-6-4-12-28-16/h4,6-10,12H,2-3,5,11,13,19H2,1H3,(H,20,21)(H2,22,23,24)/t18-/m0/s1 |
| InChIKey | CQHLHKGLJUEABQ-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|