C27H38N3O7P — CID 174524269
[2-amino-3-[N-[[4-(4-cyclohexylbutoxy)phenyl]carbamoyl]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate (PubChem CID 174524269) has the molecular formula C27H38N3O7P and a molecular weight of 547.59 g/mol. Its IUPAC name is [2-amino-3-[N-[[4-(4-cyclohexylbutoxy)phenyl]carbamoyl]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [2-amino-3-[N-[[4-(4-cyclohexylbutoxy)phenyl]carbamoyl]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174524269 |
| Molecular Formula | C27H38N3O7P |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | [2-amino-3-[N-[[4-(4-cyclohexylbutoxy)phenyl]carbamoyl]anilino]-2-methyl-3-oxopropyl] dihydrogen phosphate |
| SMILES | CC(N)(COP(=O)(O)O)C(=O)N(C(=O)Nc1ccc(OCCCCC2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H38N3O7P/c1-27(28,20-37-38(33,34)35)25(31)30(23-13-6-3-7-14-23)26(32)29-22-15-17-24(18-16-22)36-19-9-8-12-21-10-4-2-5-11-21/h3,6-7,13-18,21H,2,4-5,8-12,19-20,28H2,1H3,(H,29,32)(H2,33,34,35) |
| InChIKey | CENWDGBMEJYTSZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|