C19H29NO3 — CID 100717361
(2R)-N-(4-butoxyphenyl)-2-cyclopropyl-2-propoxypropanamide (PubChem CID 100717361) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2R)-N-(4-butoxyphenyl)-2-cyclopropyl-2-propoxypropanamide.
| Compound Name | (2R)-N-(4-butoxyphenyl)-2-cyclopropyl-2-propoxypropanamide |
|---|---|
| PubChem CID | 100717361 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (2R)-N-(4-butoxyphenyl)-2-cyclopropyl-2-propoxypropanamide |
| SMILES | CCCCOc1ccc(NC(=O)[C@](C)(OCCC)C2CC2)cc1 |
| InChI | InChI=1S/C19H29NO3/c1-4-6-14-22-17-11-9-16(10-12-17)20-18(21)19(3,15-7-8-15)23-13-5-2/h9-12,15H,4-8,13-14H2,1-3H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | UJEOLKKXQDICMS-LJQANCHMSA-N |
| XLogP | 4.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|