C17H26N2O3 — CID 100778739
(2S)-2-cyclopropyl-2-propoxy-N-(6-propoxy-3-pyridinyl)propanamide (PubChem CID 100778739) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-propoxy-N-(6-propoxy-3-pyridinyl)propanamide.
| Compound Name | (2S)-2-cyclopropyl-2-propoxy-N-(6-propoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 100778739 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-2-cyclopropyl-2-propoxy-N-(6-propoxy-3-pyridinyl)propanamide |
| SMILES | CCCOc1ccc(NC(=O)[C@@](C)(OCCC)C2CC2)cn1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-10-21-15-9-8-14(12-18-15)19-16(20)17(3,13-6-7-13)22-11-5-2/h8-9,12-13H,4-7,10-11H2,1-3H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | BPIJWJDAJVROGI-KRWDZBQOSA-N |
| XLogP | 3.40 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |