C30H34N2O4S — CID 17137888
N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 17137888) has the molecular formula C30H34N2O4S and a molecular weight of 518.68 g/mol. Its IUPAC name is N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17137888 |
| Molecular Formula | C30H34N2O4S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCCC2CCCCC2)cc1)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N2O4S/c33-29(24-11-15-27(16-12-24)36-22-21-35-26-9-5-2-6-10-26)32-30(37)31-25-13-17-28(18-14-25)34-20-19-23-7-3-1-4-8-23/h2,5-6,9-18,23H,1,3-4,7-8,19-22H2,(H2,31,32,33,37) |
| InChIKey | MKIPDESGBRVOHD-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|