C26H34N2O3S — CID 17150169
3-butan-2-yloxy-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17150169) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17150169 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-butan-2-yloxy-N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2ccc(OCCC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C26H34N2O3S/c1-3-19(2)31-24-11-7-10-21(18-24)25(29)28-26(32)27-22-12-14-23(15-13-22)30-17-16-20-8-5-4-6-9-20/h7,10-15,18-20H,3-6,8-9,16-17H2,1-2H3,(H2,27,28,29,32) |
| InChIKey | VIBNGGAOOQJELK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|