C25H32N2O3S — CID 17137887
N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide (PubChem CID 17137887) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17137887 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[[4-(2-cyclohexylethoxy)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)Nc2ccc(OCCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O3S/c1-18(2)30-23-12-8-20(9-13-23)24(28)27-25(31)26-21-10-14-22(15-11-21)29-17-16-19-6-4-3-5-7-19/h8-15,18-19H,3-7,16-17H2,1-2H3,(H2,26,27,28,31) |
| InChIKey | VRUCCECYUUMFAD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|