C21H26F3NO4 — CID 100784097
3-methyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-1,5-dioxaspiro[5.5]undecane-3-carboxamide (PubChem CID 100784097) has the molecular formula C21H26F3NO4 and a molecular weight of 413.44 g/mol. Its IUPAC name is 3-methyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-1,5-dioxaspiro[5.5]undecane-3-carboxamide.
| Compound Name | 3-methyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-1,5-dioxaspiro[5.5]undecane-3-carboxamide |
|---|---|
| PubChem CID | 100784097 |
| Molecular Formula | C21H26F3NO4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-methyl-N-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-1,5-dioxaspiro[5.5]undecane-3-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(C)COC3(CCCCC3)OC2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H26F3NO4/c1-3-11-27-17-8-7-15(12-16(17)21(22,23)24)25-18(26)19(2)13-28-20(29-14-19)9-5-4-6-10-20/h3,7-8,12H,1,4-6,9-11,13-14H2,2H3,(H,25,26) |
| InChIKey | NWTLJBCIUYZUOR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|