C24H28F3NO7 — CID 100784165
2-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane-5-carboxamide (PubChem CID 100784165) has the molecular formula C24H28F3NO7 and a molecular weight of 499.48 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100784165 |
| Molecular Formula | C24H28F3NO7 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1,3-dioxane-5-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)C2(C)COC(c3ccc(OC)c(OC)c3)OC2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H28F3NO7/c1-23(13-34-21(35-14-23)15-5-7-19(31-3)20(11-15)32-4)22(29)28-16-6-8-18(33-10-9-30-2)17(12-16)24(25,26)27/h5-8,11-12,21H,9-10,13-14H2,1-4H3,(H,28,29) |
| InChIKey | CVRQELIICLRMFZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|