C20H22ClNO4 — CID 100779634
2-(4-chlorophenyl)-N-(4-ethoxyphenyl)-5-methyl-1,3-dioxane-5-carboxamide (PubChem CID 100779634) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(4-ethoxyphenyl)-5-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(4-ethoxyphenyl)-5-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100779634 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(4-ethoxyphenyl)-5-methyl-1,3-dioxane-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(C)COC(c3ccc(Cl)cc3)OC2)cc1 |
| InChI | InChI=1S/C20H22ClNO4/c1-3-24-17-10-8-16(9-11-17)22-19(23)20(2)12-25-18(26-13-20)14-4-6-15(21)7-5-14/h4-11,18H,3,12-13H2,1-2H3,(H,22,23) |
| InChIKey | SOLOFQZMSUUDDA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |