C14H17NO5 — CID 100778858
N-(4-ethoxyphenyl)-5-methyl-2-oxo-1,3-dioxane-5-carboxamide (PubChem CID 100778858) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-methyl-2-oxo-1,3-dioxane-5-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-5-methyl-2-oxo-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100778858 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-methyl-2-oxo-1,3-dioxane-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(C)COC(=O)OC2)cc1 |
| InChI | InChI=1S/C14H17NO5/c1-3-18-11-6-4-10(5-7-11)15-12(16)14(2)8-19-13(17)20-9-14/h4-7H,3,8-9H2,1-2H3,(H,15,16) |
| InChIKey | JGRPOKCGGDVOOB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |