C14H21ClN2O2 — CID 119670703
N-(4-ethoxyphenyl)-3-methylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119670703) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-methylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(4-ethoxyphenyl)-3-methylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119670703 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-methylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)C2(C)CCNC2)cc1.Cl |
| InChI | InChI=1S/C14H20N2O2.ClH/c1-3-18-12-6-4-11(5-7-12)16-13(17)14(2)8-9-15-10-14;/h4-7,15H,3,8-10H2,1-2H3,(H,16,17);1H |
| InChIKey | RMKWSPXJUOTBHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |