C15H20N2O4 — CID 63139631
methyl 2-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenoxy]acetate (PubChem CID 63139631) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 2-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 63139631 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 2-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)C2(C)CCNC2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-15(7-8-16-10-15)14(19)17-11-3-5-12(6-4-11)21-9-13(18)20-2/h3-6,16H,7-10H2,1-2H3,(H,17,19) |
| InChIKey | VHEQKBDAUKYTNO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |