C21H27ClN2O4 — CID 119680034
N-[4-(4-ethoxyphenoxy)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119680034) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenoxy)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[4-(4-ethoxyphenoxy)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119680034 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[4-(4-ethoxyphenoxy)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)C3(OC)CCNCC3)cc2)cc1.Cl |
| InChI | InChI=1S/C21H26N2O4.ClH/c1-3-26-17-8-10-19(11-9-17)27-18-6-4-16(5-7-18)23-20(24)21(25-2)12-14-22-15-13-21;/h4-11,22H,3,12-15H2,1-2H3,(H,23,24);1H |
| InChIKey | MGNUPHUNCFKIFU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |