C19H33Cl2N3O3 — CID 119841235
N-[4-[2-(diethylamino)ethoxy]phenyl]-4-methoxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 119841235) has the molecular formula C19H33Cl2N3O3 and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethoxy]phenyl]-4-methoxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-4-methoxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119841235 |
| Molecular Formula | C19H33Cl2N3O3 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[4-[2-(diethylamino)ethoxy]phenyl]-4-methoxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCOc1ccc(NC(=O)C2(OC)CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H31N3O3.2ClH/c1-4-22(5-2)14-15-25-17-8-6-16(7-9-17)21-18(23)19(24-3)10-12-20-13-11-19;;/h6-9,20H,4-5,10-15H2,1-3H3,(H,21,23);2*1H |
| InChIKey | XIDJMTCLCLASCQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |