C21H29NO2 — CID 6595849
(3R,5R)-N-(4-ethoxyphenyl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 6595849) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3R,5R)-N-(4-ethoxyphenyl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-N-(4-ethoxyphenyl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 6595849 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (3R,5R)-N-(4-ethoxyphenyl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C23CC4C[C@@](C)(C2)C[C@@](C)(C4)C3)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-24-17-7-5-16(6-8-17)22-18(23)21-11-15-9-19(2,13-21)12-20(3,10-15)14-21/h5-8,15H,4,9-14H2,1-3H3,(H,22,23)/t15?,19-,20-,21?/m1/s1 |
| InChIKey | KOXRZHDZFMOEBP-LDEVPTQISA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |