C21H28N2O2 — CID 17168267
N-(3-acetamidophenyl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 17168267) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 17168267 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(3-acetamidophenyl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-14(24)22-16-5-4-6-17(7-16)23-18(25)21-10-15-8-19(2,12-21)11-20(3,9-15)13-21/h4-7,15H,8-13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | NMVCOPKGWDXXCW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |