C24H35NO3 — CID 112837499
N-[3-(2-ethoxyethoxymethyl)phenyl]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 112837499) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[3-(2-ethoxyethoxymethyl)phenyl]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 112837499 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | N-[3-(2-ethoxyethoxymethyl)phenyl]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CCOCCOCc1cccc(NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H35NO3/c1-4-27-8-9-28-14-18-6-5-7-20(10-18)25-21(26)24-13-19-11-22(2,16-24)15-23(3,12-19)17-24/h5-7,10,19H,4,8-9,11-17H2,1-3H3,(H,25,26) |
| InChIKey | MYKAZGFOLAUKBT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|