C28H37NO — CID 171577019
N-[3-(1-adamantylmethyl)phenyl]adamantane-1-carboxamide (PubChem CID 171577019) has the molecular formula C28H37NO and a molecular weight of 403.61 g/mol. Its IUPAC name is N-[3-(1-adamantylmethyl)phenyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(1-adamantylmethyl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171577019 |
| Molecular Formula | C28H37NO |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | N-[3-(1-adamantylmethyl)phenyl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1cccc(CC23CC4CC(CC(C4)C2)C3)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H37NO/c30-26(28-15-22-7-23(16-28)9-24(8-22)17-28)29-25-3-1-2-18(10-25)11-27-12-19-4-20(13-27)6-21(5-19)14-27/h1-3,10,19-24H,4-9,11-17H2,(H,29,30) |
| InChIKey | AMAMQJQHFMHUGQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |