C27H30N2O5 — CID 108930855
[4-[[3-(adamantane-1-carbonylamino)phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930855) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [4-[[3-(adamantane-1-carbonylamino)phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[3-(adamantane-1-carbonylamino)phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930855 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [4-[[3-(adamantane-1-carbonylamino)phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(NC(=O)C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-2-33-26(32)34-23-8-6-20(7-9-23)24(30)28-21-4-3-5-22(13-21)29-25(31)27-14-17-10-18(15-27)12-19(11-17)16-27/h3-9,13,17-19H,2,10-12,14-16H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | IWZXIUHBGIYTMV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|