C24H22N2O5 — CID 108930551
ethyl [4-[[4-[(4-methylbenzoyl)amino]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108930551) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl [4-[[4-[(4-methylbenzoyl)amino]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[4-[(4-methylbenzoyl)amino]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108930551 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl [4-[[4-[(4-methylbenzoyl)amino]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-3-30-24(29)31-21-14-8-18(9-15-21)23(28)26-20-12-10-19(11-13-20)25-22(27)17-6-4-16(2)5-7-17/h4-15H,3H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | UAFABQWFORLPCK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|