C24H22N2O7 — CID 108931347
[4-[[4-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108931347) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is [4-[[4-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[4-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931347 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [4-[[4-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2ccc(NC(=O)c3cc(O)cc(O)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O7/c1-2-32-24(31)33-21-9-5-16(6-10-21)22(29)25-14-15-3-7-18(8-4-15)26-23(30)17-11-19(27)13-20(28)12-17/h3-13,27-28H,2,14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | SPPJMDRVITWDGF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|