C31H28N2O5 — CID 108931139
[4-[[4-[(2,2-diphenylacetyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate (PubChem CID 108931139) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is [4-[[4-[(2,2-diphenylacetyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[4-[(2,2-diphenylacetyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931139 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [4-[[4-[(2,2-diphenylacetyl)amino]phenyl]methylcarbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O5/c1-2-37-31(36)38-27-19-15-25(16-20-27)29(34)32-21-22-13-17-26(18-14-22)33-30(35)28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-20,28H,2,21H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | MOONYWPOLUXJII-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|