C26H24N2O5 — CID 108930897
ethyl [4-[[3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108930897) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is ethyl [4-[[3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108930897 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl [4-[[3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(NC(=O)/C=C/c3cccc(C)c3)c2)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-3-32-26(31)33-23-13-11-20(12-14-23)25(30)28-22-9-5-8-21(17-22)27-24(29)15-10-19-7-4-6-18(2)16-19/h4-17H,3H2,1-2H3,(H,27,29)(H,28,30)/b15-10+ |
| InChIKey | FZGHRGWBGKOKAH-XNTDXEJSSA-N |
| XLogP | 5.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|