C23H32N2O2 — CID 9397326
N-[4-(3-ethylanilino)-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 9397326) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[4-(3-ethylanilino)-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-(3-ethylanilino)-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9397326 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N-[4-(3-ethylanilino)-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | CCc1cccc(NC(=O)CCCNC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H32N2O2/c1-2-16-5-3-6-20(12-16)25-21(26)7-4-8-24-22(27)23-13-17-9-18(14-23)11-19(10-17)15-23/h3,5-6,12,17-19H,2,4,7-11,13-15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | VAGGHJSJBGHBPR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|