C24H33N3O2S — CID 54787659
N-[[3-(hexanoylamino)phenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787659) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[[3-(hexanoylamino)phenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[3-(hexanoylamino)phenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787659 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[[3-(hexanoylamino)phenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=S)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H33N3O2S/c1-2-3-4-8-21(28)25-19-6-5-7-20(12-19)26-23(30)27-22(29)24-13-16-9-17(14-24)11-18(10-16)15-24/h5-7,12,16-18H,2-4,8-11,13-15H2,1H3,(H,25,28)(H2,26,27,29,30) |
| InChIKey | RMEGLWFKSITVHE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|