C23H27N3O2S — CID 26161868
N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioylamino]phenyl]hexanamide (PubChem CID 26161868) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioylamino]phenyl]hexanamide.
| Compound Name | N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioylamino]phenyl]hexanamide |
|---|---|
| PubChem CID | 26161868 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioylamino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=S)NC(=O)/C=C/c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-3-4-5-9-21(27)24-19-7-6-8-20(16-19)25-23(29)26-22(28)15-14-18-12-10-17(2)11-13-18/h6-8,10-16H,3-5,9H2,1-2H3,(H,24,27)(H2,25,26,28,29)/b15-14+ |
| InChIKey | YEAHKPJVBZLSGM-CCEZHUSRSA-N |
| XLogP | 5.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|