C22H26N2O2 — CID 26161245
N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]hexanamide (PubChem CID 26161245) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 26161245 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)/C=C/c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-4-5-9-21(25)23-19-7-6-8-20(16-19)24-22(26)15-14-18-12-10-17(2)11-13-18/h6-8,10-16H,3-5,9H2,1-2H3,(H,23,25)(H,24,26)/b15-14+ |
| InChIKey | QOHMDGVEIJSJQW-CCEZHUSRSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|