C17H25N3O2S — CID 17204726
N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]pentanamide (PubChem CID 17204726) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]pentanamide.
| Compound Name | N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 17204726 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-5-6-10-14(21)20-16(23)19-13-9-7-8-12(11-13)18-15(22)17(2,3)4/h7-9,11H,5-6,10H2,1-4H3,(H,18,22)(H2,19,20,21,23) |
| InChIKey | JBZOTTFAZJFUJY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|