C26H27N3O2S — CID 17204695
N-[3-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]-2,2-dimethylpropanamide (PubChem CID 17204695) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[3-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 17204695 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[3-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H27N3O2S/c1-26(2,3)24(31)27-20-15-10-16-21(17-20)28-25(32)29-23(30)22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-17,22H,1-3H3,(H,27,31)(H2,28,29,30,32) |
| InChIKey | SAQBYNWJMFYFMF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|