C23H21N3O2S — CID 17233208
3-[(2,2-diphenylacetyl)carbamothioylamino]-N-methylbenzamide (PubChem CID 17233208) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-[(2,2-diphenylacetyl)carbamothioylamino]-N-methylbenzamide.
| Compound Name | 3-[(2,2-diphenylacetyl)carbamothioylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 17233208 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[(2,2-diphenylacetyl)carbamothioylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O2S/c1-24-21(27)18-13-8-14-19(15-18)25-23(29)26-22(28)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,20H,1H3,(H,24,27)(H2,25,26,28,29) |
| InChIKey | WRBGRSOGTMFTIV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|