C23H20N2O3S — CID 1048113
methyl 4-[(2,2-diphenylacetyl)carbamothioylamino]benzoate (PubChem CID 1048113) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 4-[(2,2-diphenylacetyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(2,2-diphenylacetyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 1048113 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 4-[(2,2-diphenylacetyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-28-22(27)18-12-14-19(15-13-18)24-23(29)25-21(26)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15,20H,1H3,(H2,24,25,26,29) |
| InChIKey | IKOISXKOKJTCBS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|