C29H25NO3 — CID 2787213
methyl 4-(2,3,3-triphenylpropanoylamino)benzoate (PubChem CID 2787213) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is methyl 4-(2,3,3-triphenylpropanoylamino)benzoate.
| Compound Name | methyl 4-(2,3,3-triphenylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 2787213 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | methyl 4-(2,3,3-triphenylpropanoylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(c2ccccc2)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO3/c1-33-29(32)24-17-19-25(20-18-24)30-28(31)27(23-15-9-4-10-16-23)26(21-11-5-2-6-12-21)22-13-7-3-8-14-22/h2-20,26-27H,1H3,(H,30,31) |
| InChIKey | WXISAZWKZOCFEC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |