C17H15Br2NO3 — CID 2788222
methyl 4-[(2,3-dibromo-3-phenylpropanoyl)amino]benzoate (PubChem CID 2788222) has the molecular formula C17H15Br2NO3 and a molecular weight of 441.12 g/mol. Its IUPAC name is methyl 4-[(2,3-dibromo-3-phenylpropanoyl)amino]benzoate.
| Compound Name | methyl 4-[(2,3-dibromo-3-phenylpropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 2788222 |
| Molecular Formula | C17H15Br2NO3 |
| Molecular Weight | 441.12 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | methyl 4-[(2,3-dibromo-3-phenylpropanoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(Br)C(Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15Br2NO3/c1-23-17(22)12-7-9-13(10-8-12)20-16(21)15(19)14(18)11-5-3-2-4-6-11/h2-10,14-15H,1H3,(H,20,21) |
| InChIKey | PTSBITYXMQZCRO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|