C28H25N3O4S2 — CID 4631517
N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 4631517) has the molecular formula C28H25N3O4S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4631517 |
| Molecular Formula | C28H25N3O4S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H25N3O4S2/c1-35-24-16-12-23(13-17-24)31-37(33,34)25-18-14-22(15-19-25)29-28(36)30-27(32)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26,31H,1H3,(H2,29,30,32,36) |
| InChIKey | OALHQIKLMVLOGX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|