C23H20N2O2S — CID 1346261
N-[(3-acetylphenyl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 1346261) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(3-acetylphenyl)carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(3-acetylphenyl)carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1346261 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[(3-acetylphenyl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | CC(=O)c1cccc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N2O2S/c1-16(26)19-13-8-14-20(15-19)24-23(28)25-22(27)21(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-15,21H,1H3,(H2,24,25,27,28) |
| InChIKey | LHGPSHSNVZUMOJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|