C20H27N3O4S — CID 8574726
N-[3-oxo-3-(3-sulfamoylanilino)propyl]adamantane-1-carboxamide (PubChem CID 8574726) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-oxo-3-(3-sulfamoylanilino)propyl]adamantane-1-carboxamide.
| Compound Name | N-[3-oxo-3-(3-sulfamoylanilino)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 8574726 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[3-oxo-3-(3-sulfamoylanilino)propyl]adamantane-1-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H27N3O4S/c21-28(26,27)17-3-1-2-16(9-17)23-18(24)4-5-22-19(25)20-10-13-6-14(11-20)8-15(7-13)12-20/h1-3,9,13-15H,4-8,10-12H2,(H,22,25)(H,23,24)(H2,21,26,27) |
| InChIKey | SPXWOGAQSXGEDN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |