C25H28FN3O4S — CID 4826830
N-[2-[3-[(2-fluorophenyl)sulfamoyl]anilino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 4826830) has the molecular formula C25H28FN3O4S and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[2-[3-[(2-fluorophenyl)sulfamoyl]anilino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[3-[(2-fluorophenyl)sulfamoyl]anilino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4826830 |
| Molecular Formula | C25H28FN3O4S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[2-[3-[(2-fluorophenyl)sulfamoyl]anilino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)Nc1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C25H28FN3O4S/c26-21-6-1-2-7-22(21)29-34(32,33)20-5-3-4-19(11-20)28-23(30)15-27-24(31)25-12-16-8-17(13-25)10-18(9-16)14-25/h1-7,11,16-18,29H,8-10,12-15H2,(H,27,31)(H,28,30) |
| InChIKey | DCFXRQHLBJKJJW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |