C22H31N3O4S — CID 55948833
N-[2-[4-(ethylsulfonylamino)-3-methylanilino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 55948833) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is N-[2-[4-(ethylsulfonylamino)-3-methylanilino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[4-(ethylsulfonylamino)-3-methylanilino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55948833 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[2-[4-(ethylsulfonylamino)-3-methylanilino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C22H31N3O4S/c1-3-30(28,29)25-19-5-4-18(6-14(19)2)24-20(26)13-23-21(27)22-10-15-7-16(11-22)9-17(8-15)12-22/h4-6,15-17,25H,3,7-13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | QNOZYUSWSWICMK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |