C25H34N2O4S — CID 55636206
2-(1-adamantyl)-N-[2-(3-cyclopentylsulfonylanilino)-2-oxoethyl]acetamide (PubChem CID 55636206) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-(3-cyclopentylsulfonylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-(3-cyclopentylsulfonylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 55636206 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-(3-cyclopentylsulfonylanilino)-2-oxoethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)Nc1cccc(S(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C25H34N2O4S/c28-23(15-25-12-17-8-18(13-25)10-19(9-17)14-25)26-16-24(29)27-20-4-3-7-22(11-20)32(30,31)21-5-1-2-6-21/h3-4,7,11,17-19,21H,1-2,5-6,8-10,12-16H2,(H,26,28)(H,27,29) |
| InChIKey | OITUDRNUJNUCTC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |